C30H28Br2ClN3O3 — CID 126324089
6-bromo-3-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126324089) has the molecular formula C30H28Br2ClN3O3 and a molecular weight of 673.83 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126324089 |
| Molecular Formula | C30H28Br2ClN3O3 |
| Molecular Weight | 673.83 g/mol |
| Exact Mass | 671.02 |
| IUPAC Name | 6-bromo-3-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)cc(Cl)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C30H28Br2ClN3O3/c1-2-38-27-15-20(14-25(33)28(27)39-18-19-8-10-22(31)11-9-19)17-34-36-29(21-6-4-3-5-7-21)35-26-13-12-23(32)16-24(26)30(36)37/h8-17,21H,2-7,18H2,1H3 |
| InChIKey | SEZCRJLUYLFLOI-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.83 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|