C26H27BrClN3O5 — CID 126321813
methyl 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetate (PubChem CID 126321813) has the molecular formula C26H27BrClN3O5 and a molecular weight of 576.88 g/mol. Its IUPAC name is methyl 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126321813 |
| Molecular Formula | C26H27BrClN3O5 |
| Molecular Weight | 576.88 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | methyl 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)cc(Cl)c1OCC(=O)OC |
| InChI | InChI=1S/C26H27BrClN3O5/c1-3-35-22-12-16(11-20(28)24(22)36-15-23(32)34-2)14-29-31-25(17-7-5-4-6-8-17)30-21-10-9-18(27)13-19(21)26(31)33/h9-14,17H,3-8,15H2,1-2H3 |
| InChIKey | WIHWKQLWBSPQBG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.88 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|