C23H22Br3N3O2 — CID 126318008
6-bromo-2-cyclohexyl-3-[(3,5-dibromo-4-ethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126318008) has the molecular formula C23H22Br3N3O2 and a molecular weight of 612.16 g/mol. Its IUPAC name is 6-bromo-2-cyclohexyl-3-[(3,5-dibromo-4-ethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-cyclohexyl-3-[(3,5-dibromo-4-ethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126318008 |
| Molecular Formula | C23H22Br3N3O2 |
| Molecular Weight | 612.16 g/mol |
| Exact Mass | 608.93 |
| IUPAC Name | 6-bromo-2-cyclohexyl-3-[(3,5-dibromo-4-ethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1c(Br)cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)cc1Br |
| InChI | InChI=1S/C23H22Br3N3O2/c1-2-31-21-18(25)10-14(11-19(21)26)13-27-29-22(15-6-4-3-5-7-15)28-20-9-8-16(24)12-17(20)23(29)30/h8-13,15H,2-7H2,1H3 |
| InChIKey | BYYNREGLTHDUTP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.16 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|