C21H18Br3N3O2 — CID 137160443
6-bromo-2-cyclohexyl-3-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 137160443) has the molecular formula C21H18Br3N3O2 and a molecular weight of 584.11 g/mol. Its IUPAC name is 6-bromo-2-cyclohexyl-3-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-cyclohexyl-3-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 137160443 |
| Molecular Formula | C21H18Br3N3O2 |
| Molecular Weight | 584.11 g/mol |
| Exact Mass | 580.89 |
| IUPAC Name | 6-bromo-2-cyclohexyl-3-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2cc(Br)ccc2nc(C2CCCCC2)n1N=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C21H18Br3N3O2/c22-14-6-7-18-15(10-14)21(29)27(20(26-18)13-4-2-1-3-5-13)25-11-12-8-16(23)19(28)17(24)9-12/h6-11,13,28H,1-5H2 |
| InChIKey | PFBKTQNNXSXGBQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.11 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|