C21H18BrCl2N3O — CID 126328460
6-bromo-2-cyclohexyl-3-[(3,4-dichlorophenyl)methylideneamino]quinazolin-4-one (PubChem CID 126328460) has the molecular formula C21H18BrCl2N3O and a molecular weight of 479.21 g/mol. Its IUPAC name is 6-bromo-2-cyclohexyl-3-[(3,4-dichlorophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-cyclohexyl-3-[(3,4-dichlorophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126328460 |
| Molecular Formula | C21H18BrCl2N3O |
| Molecular Weight | 479.21 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | 6-bromo-2-cyclohexyl-3-[(3,4-dichlorophenyl)methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2cc(Br)ccc2nc(C2CCCCC2)n1N=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H18BrCl2N3O/c22-15-7-9-19-16(11-15)21(28)27(20(26-19)14-4-2-1-3-5-14)25-12-13-6-8-17(23)18(24)10-13/h6-12,14H,1-5H2 |
| InChIKey | JVABZSCESOADFB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.21 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|