C23H19BrCl2N4O2 — CID 126308948
2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]acetonitrile (PubChem CID 126308948) has the molecular formula C23H19BrCl2N4O2 and a molecular weight of 534.24 g/mol. Its IUPAC name is 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]acetonitrile.
| Compound Name | 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]acetonitrile |
|---|---|
| PubChem CID | 126308948 |
| Molecular Formula | C23H19BrCl2N4O2 |
| Molecular Weight | 534.24 g/mol |
| Exact Mass | 532.01 |
| IUPAC Name | 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]acetonitrile |
| SMILES | N#CCOc1c(Cl)cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)cc1Cl |
| InChI | InChI=1S/C23H19BrCl2N4O2/c24-16-6-7-20-17(12-16)23(31)30(22(29-20)15-4-2-1-3-5-15)28-13-14-10-18(25)21(19(26)11-14)32-9-8-27/h6-7,10-13,15H,1-5,9H2 |
| InChIKey | KPIXHRYWHGEIIR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.24 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|