C23H20Br2N4O2 — CID 126302744
2-[2,6-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile (PubChem CID 126302744) has the molecular formula C23H20Br2N4O2 and a molecular weight of 544.25 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile.
| Compound Name | 2-[2,6-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 126302744 |
| Molecular Formula | C23H20Br2N4O2 |
| Molecular Weight | 544.25 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | 2-[2,6-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1c(Br)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1Br |
| InChI | InChI=1S/C23H20Br2N4O2/c24-18-12-15(13-19(25)21(18)31-11-10-26)14-27-29-22(16-6-2-1-3-7-16)28-20-9-5-4-8-17(20)23(29)30/h4-5,8-9,12-14,16H,1-3,6-7,11H2 |
| InChIKey | INEIWRYKDHLCOZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.25 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|