C27H28BrClN4O4 — CID 126311682
3-[[3-bromo-5-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126311682) has the molecular formula C27H28BrClN4O4 and a molecular weight of 587.90 g/mol. Its IUPAC name is 3-[[3-bromo-5-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[3-bromo-5-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126311682 |
| Molecular Formula | C27H28BrClN4O4 |
| Molecular Weight | 587.90 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 3-[[3-bromo-5-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=C(COc1c(Cl)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1Br)N1CCOCC1 |
| InChI | InChI=1S/C27H28BrClN4O4/c28-21-14-18(15-22(29)25(21)37-17-24(34)32-10-12-36-13-11-32)16-30-33-26(19-6-2-1-3-7-19)31-23-9-5-4-8-20(23)27(33)35/h4-5,8-9,14-16,19H,1-3,6-7,10-13,17H2 |
| InChIKey | NLQKBXSITBMZFP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|