C24H24ClN3O5 — CID 126312018
2-[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126312018) has the molecular formula C24H24ClN3O5 and a molecular weight of 469.93 g/mol. Its IUPAC name is 2-[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126312018 |
| Molecular Formula | C24H24ClN3O5 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 2-[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C24H24ClN3O5/c1-32-20-12-15(11-18(25)22(20)33-14-21(29)30)13-26-28-23(16-7-3-2-4-8-16)27-19-10-6-5-9-17(19)24(28)31/h5-6,9-13,16H,2-4,7-8,14H2,1H3,(H,29,30) |
| InChIKey | NRKVNAMOYUPXQH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|