C30H28ClN3O5 — CID 126303743
3-[[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126303743) has the molecular formula C30H28ClN3O5 and a molecular weight of 546.02 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126303743 |
| Molecular Formula | C30H28ClN3O5 |
| Molecular Weight | 546.02 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 3-[[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C30H28ClN3O5/c1-38-26-16-20(15-24(31)27(26)39-18-19-8-7-11-22(14-19)30(36)37)17-32-34-28(21-9-3-2-4-10-21)33-25-13-6-5-12-23(25)29(34)35/h5-8,11-17,21H,2-4,9-10,18H2,1H3,(H,36,37) |
| InChIKey | UDDOUOXHOKCXCK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.02 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|