C29H26BrN3O4 — CID 126280838
3-[[4-bromo-2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126280838) has the molecular formula C29H26BrN3O4 and a molecular weight of 560.45 g/mol. Its IUPAC name is 3-[[4-bromo-2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-bromo-2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126280838 |
| Molecular Formula | C29H26BrN3O4 |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 3-[[4-bromo-2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccc(Br)cc2C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C29H26BrN3O4/c30-23-13-14-26(37-18-19-7-6-10-21(15-19)29(35)36)22(16-23)17-31-33-27(20-8-2-1-3-9-20)32-25-12-5-4-11-24(25)28(33)34/h4-7,10-17,20H,1-3,8-9,18H2,(H,35,36) |
| InChIKey | FPPZLMCZKKUWLB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|