C29H26N4O6 — CID 126311917
3-[[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 126311917) has the molecular formula C29H26N4O6 and a molecular weight of 526.55 g/mol. Its IUPAC name is 3-[[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126311917 |
| Molecular Formula | C29H26N4O6 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 3-[[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2c(C=Nn3c(C4CCCCC4)nc4ccccc4c3=O)cccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H26N4O6/c34-28-23-13-4-5-14-24(23)31-27(20-9-2-1-3-10-20)32(28)30-17-22-12-7-15-25(33(37)38)26(22)39-18-19-8-6-11-21(16-19)29(35)36/h4-8,11-17,20H,1-3,9-10,18H2,(H,35,36) |
| InChIKey | NKMQMEFROQYKPM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|