C31H31BrN4O4 — CID 126318159
3-[[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]methyl]benzoic acid (PubChem CID 126318159) has the molecular formula C31H31BrN4O4 and a molecular weight of 603.52 g/mol. Its IUPAC name is 3-[[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126318159 |
| Molecular Formula | C31H31BrN4O4 |
| Molecular Weight | 603.52 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | 3-[[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]methyl]benzoic acid |
| SMILES | CN(C)c1ccc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)c(OCc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C31H31BrN4O4/c1-35(2)25-13-11-23(28(17-25)40-19-20-7-6-10-22(15-20)31(38)39)18-33-36-29(21-8-4-3-5-9-21)34-27-14-12-24(32)16-26(27)30(36)37/h6-7,10-18,21H,3-5,8-9,19H2,1-2H3,(H,38,39) |
| InChIKey | IPYRXLXNXDXUJY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|