C24H24BrN3O4 — CID 126324919
methyl 2-[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetate (PubChem CID 126324919) has the molecular formula C24H24BrN3O4 and a molecular weight of 498.38 g/mol. Its IUPAC name is methyl 2-[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126324919 |
| Molecular Formula | C24H24BrN3O4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | methyl 2-[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1C=Nn1c(C2CCCCC2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C24H24BrN3O4/c1-31-22(29)15-32-21-10-6-5-9-17(21)14-26-28-23(16-7-3-2-4-8-16)27-20-12-11-18(25)13-19(20)24(28)30/h5-6,9-14,16H,2-4,7-8,15H2,1H3 |
| InChIKey | YBJZXCYGIIVWOX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|