C30H28BrClN4O3 — CID 126336645
2-[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chlorophenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126336645) has the molecular formula C30H28BrClN4O3 and a molecular weight of 607.94 g/mol. Its IUPAC name is 2-[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chlorophenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chlorophenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126336645 |
| Molecular Formula | C30H28BrClN4O3 |
| Molecular Weight | 607.94 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | 2-[2-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chlorophenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(Cl)cc1C=Nn1c(C2CCCCC2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C30H28BrClN4O3/c1-19-7-5-6-10-25(19)34-28(37)18-39-27-14-12-23(32)15-21(27)17-33-36-29(20-8-3-2-4-9-20)35-26-13-11-22(31)16-24(26)30(36)38/h5-7,10-17,20H,2-4,8-9,18H2,1H3,(H,34,37) |
| InChIKey | AXLRWQMFQAHRMF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.94 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|