C30H28Cl2N4O3 — CID 126309151
2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126309151) has the molecular formula C30H28Cl2N4O3 and a molecular weight of 563.49 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126309151 |
| Molecular Formula | C30H28Cl2N4O3 |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1c(Cl)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C30H28Cl2N4O3/c1-19-9-5-7-13-25(19)34-27(37)18-39-28-23(31)15-20(16-24(28)32)17-33-36-29(21-10-3-2-4-11-21)35-26-14-8-6-12-22(26)30(36)38/h5-9,12-17,21H,2-4,10-11,18H2,1H3,(H,34,37) |
| InChIKey | GFVFORGNTDLNGY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|