C23H21Cl2N3O4 — CID 126298167
2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetic acid (PubChem CID 126298167) has the molecular formula C23H21Cl2N3O4 and a molecular weight of 474.34 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126298167 |
| Molecular Formula | C23H21Cl2N3O4 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Cl)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C23H21Cl2N3O4/c24-17-10-14(11-18(25)21(17)32-13-20(29)30)12-26-28-22(15-6-2-1-3-7-15)27-19-9-5-4-8-16(19)23(28)31/h4-5,8-12,15H,1-3,6-7,13H2,(H,29,30) |
| InChIKey | FCKHVUNOSRKAAX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|