C26H27Cl2N3O4 — CID 126313511
ethyl (2R)-2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]propanoate (PubChem CID 126313511) has the molecular formula C26H27Cl2N3O4 and a molecular weight of 516.43 g/mol. Its IUPAC name is ethyl (2R)-2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 126313511 |
| Molecular Formula | C26H27Cl2N3O4 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | ethyl (2R)-2-[2,6-dichloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1c(Cl)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C26H27Cl2N3O4/c1-3-34-26(33)16(2)35-23-20(27)13-17(14-21(23)28)15-29-31-24(18-9-5-4-6-10-18)30-22-12-8-7-11-19(22)25(31)32/h7-8,11-16,18H,3-6,9-10H2,1-2H3/t16-/m1/s1 |
| InChIKey | UOXQYZZIIPSWQK-MRXNPFEDSA-N |
| XLogP | 5.96 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|