C24H21Cl2N3O2 — CID 126294015
2-cyclohexyl-3-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126294015) has the molecular formula C24H21Cl2N3O2 and a molecular weight of 454.36 g/mol. Its IUPAC name is 2-cyclohexyl-3-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126294015 |
| Molecular Formula | C24H21Cl2N3O2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-cyclohexyl-3-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | C#CCOc1c(Cl)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C24H21Cl2N3O2/c1-2-12-31-22-19(25)13-16(14-20(22)26)15-27-29-23(17-8-4-3-5-9-17)28-21-11-7-6-10-18(21)24(29)30/h1,6-7,10-11,13-15,17H,3-5,8-9,12H2 |
| InChIKey | ABPNILCGFLINSD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|