C28H24BrClFN3O2 — CID 126302100
3-[[3-bromo-5-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126302100) has the molecular formula C28H24BrClFN3O2 and a molecular weight of 568.87 g/mol. Its IUPAC name is 3-[[3-bromo-5-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[3-bromo-5-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126302100 |
| Molecular Formula | C28H24BrClFN3O2 |
| Molecular Weight | 568.87 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | 3-[[3-bromo-5-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1cc(Cl)c(OCc2ccccc2F)c(Br)c1 |
| InChI | InChI=1S/C28H24BrClFN3O2/c29-22-14-18(15-23(30)26(22)36-17-20-10-4-6-12-24(20)31)16-32-34-27(19-8-2-1-3-9-19)33-25-13-7-5-11-21(25)28(34)35/h4-7,10-16,19H,1-3,8-9,17H2 |
| InChIKey | GNJPCLKHWLJJBQ-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.87 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|