C32H27BrN4O4 — CID 126311235
3-[[3-bromo-4-(naphthalen-1-ylmethoxy)-5-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126311235) has the molecular formula C32H27BrN4O4 and a molecular weight of 611.50 g/mol. Its IUPAC name is 3-[[3-bromo-4-(naphthalen-1-ylmethoxy)-5-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[3-bromo-4-(naphthalen-1-ylmethoxy)-5-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126311235 |
| Molecular Formula | C32H27BrN4O4 |
| Molecular Weight | 611.50 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 3-[[3-bromo-4-(naphthalen-1-ylmethoxy)-5-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1cc(Br)c(OCc2cccc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H27BrN4O4/c33-27-17-21(18-29(37(39)40)30(27)41-20-24-13-8-12-22-9-4-5-14-25(22)24)19-34-36-31(23-10-2-1-3-11-23)35-28-16-7-6-15-26(28)32(36)38/h4-9,12-19,23H,1-3,10-11,20H2 |
| InChIKey | LNXWPTDFVZCBJK-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.50 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|