C28H24BrCl2N3O2 — CID 126307309
3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126307309) has the molecular formula C28H24BrCl2N3O2 and a molecular weight of 585.33 g/mol. Its IUPAC name is 3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126307309 |
| Molecular Formula | C28H24BrCl2N3O2 |
| Molecular Weight | 585.33 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | 3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1ccc(OCc2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C28H24BrCl2N3O2/c29-23-14-18(10-13-26(23)36-17-20-11-12-21(30)15-24(20)31)16-32-34-27(19-6-2-1-3-7-19)33-25-9-5-4-8-22(25)28(34)35/h4-5,8-16,19H,1-3,6-7,17H2 |
| InChIKey | ZZAQWFCEILESGF-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.33 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|