C29H25ClN4O2 — CID 126291166
2-[[4-chloro-2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzonitrile (PubChem CID 126291166) has the molecular formula C29H25ClN4O2 and a molecular weight of 497.00 g/mol. Its IUPAC name is 2-[[4-chloro-2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-chloro-2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126291166 |
| Molecular Formula | C29H25ClN4O2 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-[[4-chloro-2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(Cl)cc1C=Nn1c(C2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C29H25ClN4O2/c30-24-14-15-27(36-19-22-11-5-4-10-21(22)17-31)23(16-24)18-32-34-28(20-8-2-1-3-9-20)33-26-13-7-6-12-25(26)29(34)35/h4-7,10-16,18,20H,1-3,8-9,19H2 |
| InChIKey | SMHMXEYZAUVEKZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|