C28H25Cl2N3O2 — CID 126290795
2-cyclohexyl-3-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126290795) has the molecular formula C28H25Cl2N3O2 and a molecular weight of 506.43 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126290795 |
| Molecular Formula | C28H25Cl2N3O2 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 2-cyclohexyl-3-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C28H25Cl2N3O2/c29-22-13-12-21(25(30)16-22)18-35-23-14-10-19(11-15-23)17-31-33-27(20-6-2-1-3-7-20)32-26-9-5-4-8-24(26)28(33)34/h4-5,8-17,20H,1-3,6-7,18H2 |
| InChIKey | LZFVTSJTEOEBMX-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|