C26H29N3O4 — CID 126312277
propan-2-yl 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetate (PubChem CID 126312277) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126312277 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | propan-2-yl 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-18(2)33-24(30)17-32-21-14-12-19(13-15-21)16-27-29-25(20-8-4-3-5-9-20)28-23-11-7-6-10-22(23)26(29)31/h6-7,10-16,18,20H,3-5,8-9,17H2,1-2H3 |
| InChIKey | PFSWHZVXRRVELY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|