C25H29N3O2 — CID 126289077
3-[[3-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126289077) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-[[3-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[3-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126289077 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 3-[[3-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | CC[C@H](C)Oc1cccc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C25H29N3O2/c1-3-18(2)30-21-13-9-10-19(16-21)17-26-28-24(20-11-5-4-6-12-20)27-23-15-8-7-14-22(23)25(28)29/h7-10,13-18,20H,3-6,11-12H2,1-2H3/t18-/m0/s1 |
| InChIKey | PNKLQGZSVADIHR-SFHVURJKSA-N |
| XLogP | 5.50 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|