C24H27N3O2 — CID 126284648
2-cyclohexyl-3-[(2-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126284648) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-cyclohexyl-3-[(2-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[(2-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126284648 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 2-cyclohexyl-3-[(2-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC(C)Oc1ccccc1C=Nn1c(C2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H27N3O2/c1-17(2)29-22-15-9-6-12-19(22)16-25-27-23(18-10-4-3-5-11-18)26-21-14-8-7-13-20(21)24(27)28/h6-9,12-18H,3-5,10-11H2,1-2H3 |
| InChIKey | FETBFENFYHTWGX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|