C26H29Br2N3O3 — CID 126302076
2-cyclohexyl-3-[[2,3-dibromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126302076) has the molecular formula C26H29Br2N3O3 and a molecular weight of 591.34 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[2,3-dibromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[2,3-dibromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126302076 |
| Molecular Formula | C26H29Br2N3O3 |
| Molecular Weight | 591.34 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | 2-cyclohexyl-3-[[2,3-dibromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)Oc1c(OC)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c(Br)c1Br |
| InChI | InChI=1S/C26H29Br2N3O3/c1-4-16(2)34-24-21(33-3)14-18(22(27)23(24)28)15-29-31-25(17-10-6-5-7-11-17)30-20-13-9-8-12-19(20)26(31)32/h8-9,12-17H,4-7,10-11H2,1-3H3/t16-/m1/s1 |
| InChIKey | GLKPBEYAFKRPPT-MRXNPFEDSA-N |
| XLogP | 7.04 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.34 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|