C24H23Br2N3O4 — CID 126305785
[2,3-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate (PubChem CID 126305785) has the molecular formula C24H23Br2N3O4 and a molecular weight of 577.27 g/mol. Its IUPAC name is [2,3-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate.
| Compound Name | [2,3-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 126305785 |
| Molecular Formula | C24H23Br2N3O4 |
| Molecular Weight | 577.27 g/mol |
| Exact Mass | 575.01 |
| IUPAC Name | [2,3-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate |
| SMILES | COc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c(Br)c(Br)c1OC(C)=O |
| InChI | InChI=1S/C24H23Br2N3O4/c1-14(30)33-22-19(32-2)12-16(20(25)21(22)26)13-27-29-23(15-8-4-3-5-9-15)28-18-11-7-6-10-17(18)24(29)31/h6-7,10-13,15H,3-5,8-9H2,1-2H3 |
| InChIKey | UNJYZFLYBWNQFF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.27 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|