C23H23N3O3 — CID 126307849
[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenyl] acetate (PubChem CID 126307849) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is [2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenyl] acetate.
| Compound Name | [2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenyl] acetate |
|---|---|
| PubChem CID | 126307849 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C=Nn1c(C2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H23N3O3/c1-16(27)29-21-14-8-5-11-18(21)15-24-26-22(17-9-3-2-4-10-17)25-20-13-7-6-12-19(20)23(26)28/h5-8,11-15,17H,2-4,9-10H2,1H3 |
| InChIKey | DDAHNGLZLFQTPY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|