C23H24ClN3O2 — CID 126284783
3-[(5-chloro-2-ethoxyphenyl)methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126284783) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 3-[(5-chloro-2-ethoxyphenyl)methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[(5-chloro-2-ethoxyphenyl)methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126284783 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[(5-chloro-2-ethoxyphenyl)methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | CCOc1ccc(Cl)cc1C=Nn1c(C2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H24ClN3O2/c1-2-29-21-13-12-18(24)14-17(21)15-25-27-22(16-8-4-3-5-9-16)26-20-11-7-6-10-19(20)23(27)28/h6-7,10-16H,2-5,8-9H2,1H3 |
| InChIKey | GKJYIJIFPWATAI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|