C25H24ClN3O3 — CID 126286700
3-[(5-chloro-3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126286700) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is 3-[(5-chloro-3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[(5-chloro-3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126286700 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-[(5-chloro-3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | C#CCOc1c(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc(Cl)cc1OC |
| InChI | InChI=1S/C25H24ClN3O3/c1-3-13-32-23-18(14-19(26)15-22(23)31-2)16-27-29-24(17-9-5-4-6-10-17)28-21-12-8-7-11-20(21)25(29)30/h1,7-8,11-12,14-17H,4-6,9-10,13H2,2H3 |
| InChIKey | KFZBRQZWVKGUBM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|