C27H24ClN5O5 — CID 126314673
3-[[5-chloro-3-methoxy-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126314673) has the molecular formula C27H24ClN5O5 and a molecular weight of 533.97 g/mol. Its IUPAC name is 3-[[5-chloro-3-methoxy-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[5-chloro-3-methoxy-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126314673 |
| Molecular Formula | C27H24ClN5O5 |
| Molecular Weight | 533.97 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 3-[[5-chloro-3-methoxy-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | COc1cc(Cl)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C27H24ClN5O5/c1-37-23-14-19(28)13-18(25(23)38-24-12-11-20(16-29-24)33(35)36)15-30-32-26(17-7-3-2-4-8-17)31-22-10-6-5-9-21(22)27(32)34/h5-6,9-17H,2-4,7-8H2,1H3 |
| InChIKey | XVEHVVSNEXJHFR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 121.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.97 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|