C28H29N5O4 — CID 126293890
2-cyclohexyl-3-[[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126293890) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126293890 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 2-cyclohexyl-3-[[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc([N+](=O)[O-])ccc1-n1c(C)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C28H29N5O4/c1-18-15-21(19(2)31(18)25-14-13-22(33(35)36)16-26(25)37-3)17-29-32-27(20-9-5-4-6-10-20)30-24-12-8-7-11-23(24)28(32)34/h7-8,11-17,20H,4-6,9-10H2,1-3H3 |
| InChIKey | YPHVMEKPZYQESM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 104.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|