C29H22F3N5O4 — CID 126306502
3-[[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126306502) has the molecular formula C29H22F3N5O4 and a molecular weight of 561.52 g/mol. Its IUPAC name is 3-[[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126306502 |
| Molecular Formula | C29H22F3N5O4 |
| Molecular Weight | 561.52 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 3-[[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | COc1cc([N+](=O)[O-])ccc1-n1c(C)cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C29H22F3N5O4/c1-17-13-20(18(2)35(17)25-12-11-22(37(39)40)15-26(25)41-3)16-33-36-27(19-7-6-8-21(14-19)29(30,31)32)34-24-10-5-4-9-23(24)28(36)38/h4-16H,1-3H3 |
| InChIKey | YNOAHTYHFVKIPF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 104.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|