C24H18F3N3O3 — CID 126303154
3-[(2,3-dimethoxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126303154) has the molecular formula C24H18F3N3O3 and a molecular weight of 453.42 g/mol. Its IUPAC name is 3-[(2,3-dimethoxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[(2,3-dimethoxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126303154 |
| Molecular Formula | C24H18F3N3O3 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 3-[(2,3-dimethoxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | COc1cccc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c1OC |
| InChI | InChI=1S/C24H18F3N3O3/c1-32-20-12-6-8-16(21(20)33-2)14-28-30-22(15-7-5-9-17(13-15)24(25,26)27)29-19-11-4-3-10-18(19)23(30)31/h3-14H,1-2H3 |
| InChIKey | JSWXFZLDFZOKSS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|