C25H16Br2F3N3O5 — CID 126287902
2-[2,3-dibromo-6-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetic acid (PubChem CID 126287902) has the molecular formula C25H16Br2F3N3O5 and a molecular weight of 655.22 g/mol. Its IUPAC name is 2-[2,3-dibromo-6-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2,3-dibromo-6-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126287902 |
| Molecular Formula | C25H16Br2F3N3O5 |
| Molecular Weight | 655.22 g/mol |
| Exact Mass | 652.94 |
| IUPAC Name | 2-[2,3-dibromo-6-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetic acid |
| SMILES | COc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c(Br)c(Br)c1OCC(=O)O |
| InChI | InChI=1S/C25H16Br2F3N3O5/c1-37-18-10-14(20(26)21(27)22(18)38-12-19(34)35)11-31-33-23(13-5-4-6-15(9-13)25(28,29)30)32-17-8-3-2-7-16(17)24(33)36/h2-11H,12H2,1H3,(H,34,35) |
| InChIKey | OARSYVYBDRSJKW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.22 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|