C24H15BrF3N3O4 — CID 126300085
2-[4-bromo-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetic acid (PubChem CID 126300085) has the molecular formula C24H15BrF3N3O4 and a molecular weight of 546.30 g/mol. Its IUPAC name is 2-[4-bromo-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-bromo-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126300085 |
| Molecular Formula | C24H15BrF3N3O4 |
| Molecular Weight | 546.30 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | 2-[4-bromo-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Br)cc1C=Nn1c(-c2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H15BrF3N3O4/c25-17-8-9-20(35-13-21(32)33)15(11-17)12-29-31-22(14-4-3-5-16(10-14)24(26,27)28)30-19-7-2-1-6-18(19)23(31)34/h1-12H,13H2,(H,32,33) |
| InChIKey | KCGPTIFXNJDMCE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|