C29H18Br2F3N3O2 — CID 126287908
3-[[2-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126287908) has the molecular formula C29H18Br2F3N3O2 and a molecular weight of 657.28 g/mol. Its IUPAC name is 3-[[2-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[2-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126287908 |
| Molecular Formula | C29H18Br2F3N3O2 |
| Molecular Weight | 657.28 g/mol |
| Exact Mass | 654.97 |
| IUPAC Name | 3-[[2-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cccc(C(F)(F)F)c2)n1N=Cc1ccccc1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C29H18Br2F3N3O2/c30-22-13-12-20(24(31)15-22)17-39-26-11-4-1-6-19(26)16-35-37-27(18-7-5-8-21(14-18)29(32,33)34)36-25-10-3-2-9-23(25)28(37)38/h1-16H,17H2 |
| InChIKey | OBDRMYLQLXSXEO-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.28 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|