C27H21BrF3N3O4 — CID 126290603
propan-2-yl 2-[4-bromo-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetate (PubChem CID 126290603) has the molecular formula C27H21BrF3N3O4 and a molecular weight of 588.38 g/mol. Its IUPAC name is propan-2-yl 2-[4-bromo-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-bromo-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126290603 |
| Molecular Formula | C27H21BrF3N3O4 |
| Molecular Weight | 588.38 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | propan-2-yl 2-[4-bromo-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc(Br)cc1C=Nn1c(-c2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H21BrF3N3O4/c1-16(2)38-24(35)15-37-23-11-10-20(28)13-18(23)14-32-34-25(17-6-5-7-19(12-17)27(29,30)31)33-22-9-4-3-8-21(22)26(34)36/h3-14,16H,15H2,1-2H3 |
| InChIKey | SYKJVISTEIPUDI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|