C33H20Br2F3N3O2 — CID 126300108
3-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126300108) has the molecular formula C33H20Br2F3N3O2 and a molecular weight of 707.34 g/mol. Its IUPAC name is 3-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126300108 |
| Molecular Formula | C33H20Br2F3N3O2 |
| Molecular Weight | 707.34 g/mol |
| Exact Mass | 704.99 |
| IUPAC Name | 3-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cccc(C(F)(F)F)c2)n1N=Cc1cc(Br)c(OCc2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C33H20Br2F3N3O2/c34-27-15-20(16-28(35)30(27)43-19-23-10-5-8-21-7-1-2-12-25(21)23)18-39-41-31(22-9-6-11-24(17-22)33(36,37)38)40-29-14-4-3-13-26(29)32(41)42/h1-18H,19H2 |
| InChIKey | MNNSQFVERQSWKH-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.34 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|