C26H20Br2F3N3O2 — CID 126302085
3-[[3,5-dibromo-4-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126302085) has the molecular formula C26H20Br2F3N3O2 and a molecular weight of 623.27 g/mol. Its IUPAC name is 3-[[3,5-dibromo-4-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[3,5-dibromo-4-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126302085 |
| Molecular Formula | C26H20Br2F3N3O2 |
| Molecular Weight | 623.27 g/mol |
| Exact Mass | 620.99 |
| IUPAC Name | 3-[[3,5-dibromo-4-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CC[C@H](C)Oc1c(Br)cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1Br |
| InChI | InChI=1S/C26H20Br2F3N3O2/c1-3-15(2)36-23-20(27)11-16(12-21(23)28)14-32-34-24(17-7-6-8-18(13-17)26(29,30)31)33-22-10-5-4-9-19(22)25(34)35/h4-15H,3H2,1-2H3/t15-/m0/s1 |
| InChIKey | GLQWRDKVLUBTBY-HNNXBMFYSA-N |
| XLogP | 7.67 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.27 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|