C25H16Cl2F3N3O4 — CID 126293567
(2S)-2-[2,6-dichloro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid (PubChem CID 126293567) has the molecular formula C25H16Cl2F3N3O4 and a molecular weight of 550.32 g/mol. Its IUPAC name is (2S)-2-[2,6-dichloro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[2,6-dichloro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126293567 |
| Molecular Formula | C25H16Cl2F3N3O4 |
| Molecular Weight | 550.32 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | (2S)-2-[2,6-dichloro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid |
| SMILES | C[C@H](Oc1c(Cl)cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C25H16Cl2F3N3O4/c1-13(24(35)36)37-21-18(26)9-14(10-19(21)27)12-31-33-22(15-5-4-6-16(11-15)25(28,29)30)32-20-8-3-2-7-17(20)23(33)34/h2-13H,1H3,(H,35,36)/t13-/m0/s1 |
| InChIKey | UZAQRZZHPUPONM-ZDUSSCGKSA-N |
| XLogP | 6.12 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.32 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|