C22H13ClF3N3O — CID 126300832
3-[(4-chlorophenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126300832) has the molecular formula C22H13ClF3N3O and a molecular weight of 427.81 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[(4-chlorophenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126300832 |
| Molecular Formula | C22H13ClF3N3O |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 3-[(4-chlorophenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cccc(C(F)(F)F)c2)n1N=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H13ClF3N3O/c23-17-10-8-14(9-11-17)13-27-29-20(15-4-3-5-16(12-15)22(24,25)26)28-19-7-2-1-6-18(19)21(29)30/h1-13H |
| InChIKey | CDRPDURIRPESFI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|