C26H21ClF3N3O2 — CID 126289802
3-[[4-[(2R)-butan-2-yl]oxy-3-chlorophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126289802) has the molecular formula C26H21ClF3N3O2 and a molecular weight of 499.92 g/mol. Its IUPAC name is 3-[[4-[(2R)-butan-2-yl]oxy-3-chlorophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[4-[(2R)-butan-2-yl]oxy-3-chlorophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126289802 |
| Molecular Formula | C26H21ClF3N3O2 |
| Molecular Weight | 499.92 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 3-[[4-[(2R)-butan-2-yl]oxy-3-chlorophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CC[C@@H](C)Oc1ccc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C26H21ClF3N3O2/c1-3-16(2)35-23-12-11-17(13-21(23)27)15-31-33-24(18-7-6-8-19(14-18)26(28,29)30)32-22-10-5-4-9-20(22)25(33)34/h4-16H,3H2,1-2H3/t16-/m1/s1 |
| InChIKey | RJJQESCFZMGDSW-MRXNPFEDSA-N |
| XLogP | 6.80 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.92 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|