C27H21ClF3N3O5 — CID 126284784
(2S)-2-[2-chloro-6-ethoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid (PubChem CID 126284784) has the molecular formula C27H21ClF3N3O5 and a molecular weight of 559.93 g/mol. Its IUPAC name is (2S)-2-[2-chloro-6-ethoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-chloro-6-ethoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126284784 |
| Molecular Formula | C27H21ClF3N3O5 |
| Molecular Weight | 559.93 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | (2S)-2-[2-chloro-6-ethoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid |
| SMILES | CCOc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc(Cl)c1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C27H21ClF3N3O5/c1-3-38-22-12-16(11-20(28)23(22)39-15(2)26(36)37)14-32-34-24(17-7-6-8-18(13-17)27(29,30)31)33-21-10-5-4-9-19(21)25(34)35/h4-15H,3H2,1-2H3,(H,36,37)/t15-/m0/s1 |
| InChIKey | GKSYRIBONMZCEX-HNNXBMFYSA-N |
| XLogP | 5.87 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.93 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|