C25H17F3IN3O4 — CID 126301687
(2R)-2-[2-iodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid (PubChem CID 126301687) has the molecular formula C25H17F3IN3O4 and a molecular weight of 607.33 g/mol. Its IUPAC name is (2R)-2-[2-iodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-iodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126301687 |
| Molecular Formula | C25H17F3IN3O4 |
| Molecular Weight | 607.33 g/mol |
| Exact Mass | 607.02 |
| IUPAC Name | (2R)-2-[2-iodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1ccc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1I)C(=O)O |
| InChI | InChI=1S/C25H17F3IN3O4/c1-14(24(34)35)36-21-10-9-15(11-19(21)29)13-30-32-22(16-5-4-6-17(12-16)25(26,27)28)31-20-8-3-2-7-18(20)23(32)33/h2-14H,1H3,(H,34,35)/t14-/m1/s1 |
| InChIKey | FOGSJHSNVMVYLN-CQSZACIVSA-N |
| XLogP | 5.42 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.33 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|