C26H18F3I2N3O4 — CID 126290541
methyl (2S)-2-[2,6-diiodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoate (PubChem CID 126290541) has the molecular formula C26H18F3I2N3O4 and a molecular weight of 747.25 g/mol. Its IUPAC name is methyl (2S)-2-[2,6-diiodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoate.
| Compound Name | methyl (2S)-2-[2,6-diiodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 126290541 |
| Molecular Formula | C26H18F3I2N3O4 |
| Molecular Weight | 747.25 g/mol |
| Exact Mass | 746.93 |
| IUPAC Name | methyl (2S)-2-[2,6-diiodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]propanoate |
| SMILES | COC(=O)[C@H](C)Oc1c(I)cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1I |
| InChI | InChI=1S/C26H18F3I2N3O4/c1-14(25(36)37-2)38-22-19(30)10-15(11-20(22)31)13-32-34-23(16-6-5-7-17(12-16)26(27,28)29)33-21-9-4-3-8-18(21)24(34)35/h3-14H,1-2H3/t14-/m0/s1 |
| InChIKey | SSPKCDGNDOSMSS-AWEZNQCLSA-N |
| XLogP | 6.11 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.25 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|