C31H21F4IN4O4 — CID 126306463
N-(4-fluorophenyl)-2-[2-iodo-6-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide (PubChem CID 126306463) has the molecular formula C31H21F4IN4O4 and a molecular weight of 716.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-iodo-6-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-iodo-6-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126306463 |
| Molecular Formula | C31H21F4IN4O4 |
| Molecular Weight | 716.43 g/mol |
| Exact Mass | 716.05 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-iodo-6-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide |
| SMILES | COc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc(I)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C31H21F4IN4O4/c1-43-26-14-18(13-24(36)28(26)44-17-27(41)38-22-11-9-21(32)10-12-22)16-37-40-29(19-5-4-6-20(15-19)31(33,34)35)39-25-8-3-2-7-23(25)30(40)42/h2-16H,17H2,1H3,(H,38,41) |
| InChIKey | VYULEBWADFAJBL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|