C32H23F4N5O6 — CID 126302824
2-[2-ethoxy-6-nitro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]-N-(3-fluorophenyl)acetamide (PubChem CID 126302824) has the molecular formula C32H23F4N5O6 and a molecular weight of 649.56 g/mol. Its IUPAC name is 2-[2-ethoxy-6-nitro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[2-ethoxy-6-nitro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126302824 |
| Molecular Formula | C32H23F4N5O6 |
| Molecular Weight | 649.56 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | 2-[2-ethoxy-6-nitro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]-N-(3-fluorophenyl)acetamide |
| SMILES | CCOc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C32H23F4N5O6/c1-2-46-27-14-19(13-26(41(44)45)29(27)47-18-28(42)38-23-10-6-9-22(33)16-23)17-37-40-30(20-7-5-8-21(15-20)32(34,35)36)39-25-12-4-3-11-24(25)31(40)43/h3-17H,2,18H2,1H3,(H,38,42) |
| InChIKey | UTHFJFLESYYBGM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|